summaryrefslogtreecommitdiff
path: root/source/application/main
diff options
context:
space:
mode:
Diffstat (limited to 'source/application/main')
-rw-r--r--source/application/main/Classifier.cc191
-rw-r--r--source/application/main/Main.cc70
-rw-r--r--source/application/main/Mfcc.cc354
-rw-r--r--source/application/main/PlatformMath.cc196
-rw-r--r--source/application/main/Profiler.cc219
-rw-r--r--source/application/main/UseCaseCommonUtils.cc119
-rw-r--r--source/application/main/include/AppContext.hpp102
-rw-r--r--source/application/main/include/AudioUtils.hpp171
-rw-r--r--source/application/main/include/ClassificationResult.hpp41
-rw-r--r--source/application/main/include/Classifier.hpp74
-rw-r--r--source/application/main/include/DataStructures.hpp132
-rw-r--r--source/application/main/include/Mfcc.hpp255
-rw-r--r--source/application/main/include/PlatformMath.hpp151
-rw-r--r--source/application/main/include/Profiler.hpp110
-rw-r--r--source/application/main/include/UseCaseCommonUtils.hpp76
15 files changed, 2261 insertions, 0 deletions
diff --git a/source/application/main/Classifier.cc b/source/application/main/Classifier.cc
new file mode 100644
index 0000000..bc2c378
--- /dev/null
+++ b/source/application/main/Classifier.cc
@@ -0,0 +1,191 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "Classifier.hpp"
+
+#include "hal.h"
+#include "TensorFlowLiteMicro.hpp"
+
+#include <vector>
+#include <string>
+#include <set>
+#include <cstdint>
+
+namespace arm {
+namespace app {
+
+ template<typename T>
+ bool Classifier::_GetTopNResults(TfLiteTensor* tensor,
+ std::vector<ClassificationResult>& vecResults,
+ uint32_t topNCount,
+ const std::vector <std::string>& labels)
+ {
+ std::set<std::pair<T, uint32_t>> sortedSet;
+
+ /* NOTE: inputVec's size verification against labels should be
+ * checked by the calling/public function. */
+ T* tensorData = tflite::GetTensorData<T>(tensor);
+
+ /* Set initial elements. */
+ for (uint32_t i = 0; i < topNCount; ++i) {
+ sortedSet.insert({tensorData[i], i});
+ }
+
+ /* Initialise iterator. */
+ auto setFwdIter = sortedSet.begin();
+
+ /* Scan through the rest of elements with compare operations. */
+ for (uint32_t i = topNCount; i < labels.size(); ++i) {
+ if (setFwdIter->first < tensorData[i]) {
+ sortedSet.erase(*setFwdIter);
+ sortedSet.insert({tensorData[i], i});
+ setFwdIter = sortedSet.begin();
+ }
+ }
+
+ /* Final results' container. */
+ vecResults = std::vector<ClassificationResult>(topNCount);
+
+ /* For getting the floating point values, we need quantization parameters. */
+ QuantParams quantParams = GetTensorQuantParams(tensor);
+
+ /* Reset the iterator to the largest element - use reverse iterator. */
+ auto setRevIter = sortedSet.rbegin();
+
+ /* Populate results
+ * Note: we could combine this loop with the loop above, but that
+ * would, involve more multiplications and other operations.
+ **/
+ for (size_t i = 0; i < vecResults.size(); ++i, ++setRevIter) {
+ double score = static_cast<int> (setRevIter->first);
+ vecResults[i].m_normalisedVal = quantParams.scale *
+ (score - quantParams.offset);
+ vecResults[i].m_label = labels[setRevIter->second];
+ vecResults[i].m_labelIdx = setRevIter->second;
+ }
+
+ return true;
+ }
+
+ template<>
+ bool Classifier::_GetTopNResults<float>(TfLiteTensor* tensor,
+ std::vector<ClassificationResult>& vecResults,
+ uint32_t topNCount,
+ const std::vector <std::string>& labels)
+ {
+ std::set<std::pair<float, uint32_t>> sortedSet;
+
+ /* NOTE: inputVec's size verification against labels should be
+ * checked by the calling/public function. */
+ float* tensorData = tflite::GetTensorData<float>(tensor);
+
+ /* Set initial elements. */
+ for (uint32_t i = 0; i < topNCount; ++i) {
+ sortedSet.insert({tensorData[i], i});
+ }
+
+ /* Initialise iterator. */
+ auto setFwdIter = sortedSet.begin();
+
+ /* Scan through the rest of elements with compare operations. */
+ for (uint32_t i = topNCount; i < labels.size(); ++i) {
+ if (setFwdIter->first < tensorData[i]) {
+ sortedSet.erase(*setFwdIter);
+ sortedSet.insert({tensorData[i], i});
+ setFwdIter = sortedSet.begin();
+ }
+ }
+
+ /* Final results' container. */
+ vecResults = std::vector<ClassificationResult>(topNCount);
+
+ /* Reset the iterator to the largest element - use reverse iterator. */
+ auto setRevIter = sortedSet.rbegin();
+
+ /* Populate results
+ * Note: we could combine this loop with the loop above, but that
+ * would, involve more multiplications and other operations.
+ **/
+ for (size_t i = 0; i < vecResults.size(); ++i, ++setRevIter) {
+ vecResults[i].m_normalisedVal = setRevIter->first;
+ vecResults[i].m_label = labels[setRevIter->second];
+ vecResults[i].m_labelIdx = setRevIter->second;
+ }
+
+ return true;
+ }
+
+ template bool Classifier::_GetTopNResults<uint8_t>(TfLiteTensor* tensor,
+ std::vector<ClassificationResult>& vecResults,
+ uint32_t topNCount, const std::vector <std::string>& labels);
+
+ template bool Classifier::_GetTopNResults<int8_t>(TfLiteTensor* tensor,
+ std::vector<ClassificationResult>& vecResults,
+ uint32_t topNCount, const std::vector <std::string>& labels);
+
+ bool Classifier::GetClassificationResults(
+ TfLiteTensor* outputTensor,
+ std::vector<ClassificationResult>& vecResults,
+ const std::vector <std::string>& labels, uint32_t topNCount)
+ {
+ if (outputTensor == nullptr) {
+ printf_err("Output vector is null pointer.\n");
+ return false;
+ }
+
+ uint32_t totalOutputSize = 1;
+ for (int inputDim = 0; inputDim < outputTensor->dims->size; inputDim++){
+ totalOutputSize *= outputTensor->dims->data[inputDim];
+ }
+
+ /* Sanity checks. */
+ if (totalOutputSize < topNCount) {
+ printf_err("Output vector is smaller than %u\n", topNCount);
+ return false;
+ } else if (totalOutputSize != labels.size()) {
+ printf_err("Output size doesn't match the labels' size\n");
+ return false;
+ }
+
+ bool resultState;
+ vecResults.clear();
+
+ /* Get the top N results. */
+ switch (outputTensor->type) {
+ case kTfLiteUInt8:
+ resultState = _GetTopNResults<uint8_t>(outputTensor, vecResults, topNCount, labels);
+ break;
+ case kTfLiteInt8:
+ resultState = _GetTopNResults<int8_t>(outputTensor, vecResults, topNCount, labels);
+ break;
+ case kTfLiteFloat32:
+ resultState = _GetTopNResults<float>(outputTensor, vecResults, topNCount, labels);
+ break;
+ default:
+ printf_err("Tensor type %s not supported by classifier\n", TfLiteTypeGetName(outputTensor->type));
+ return false;
+ }
+
+ if (!resultState) {
+ printf_err("Failed to get sorted set\n");
+ return false;
+ }
+
+ return true;
+ }
+
+} /* namespace app */
+} /* namespace arm */ \ No newline at end of file
diff --git a/source/application/main/Main.cc b/source/application/main/Main.cc
new file mode 100644
index 0000000..6e1c620
--- /dev/null
+++ b/source/application/main/Main.cc
@@ -0,0 +1,70 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/****************************************************************************\
+ * Main application file for ARM NPU on MPS3 board *
+\****************************************************************************/
+
+#include "hal.h" /* our hardware abstraction api */
+#include "TensorFlowLiteMicro.hpp" /* our inference logic api */
+
+#include <cstdio>
+
+extern void main_loop(hal_platform& platform);
+
+#if defined(__ARMCC_VERSION) && (__ARMCC_VERSION >= 6010050)
+__ASM(" .global __ARM_use_no_argv\n");
+#endif
+
+/* Print application information. */
+static void print_application_intro()
+{
+ info("%s\n", PRJ_DES_STR);
+ info("Target system design: %s\n", DESIGN_NAME);
+ info("Version %s Build date: " __DATE__ " @ " __TIME__ "\n", PRJ_VER_STR);
+ info("Copyright (C) ARM Ltd 2020. All rights reserved.\n\n");
+}
+
+int main ()
+{
+ hal_platform platform;
+ data_acq_module dataAcq;
+ data_psn_module dataPsn;
+ platform_timer timer;
+
+ /* Initialise the HAL and platform. */
+ hal_init(&platform, &dataAcq, &dataPsn, &timer);
+
+ if (0 == hal_platform_init(&platform)) {
+ /* Application information, UART should have been initialised. */
+ print_application_intro();
+
+ /* Check the version of TensorFlow Lite Micro. */
+ PrintTensorFlowVersion();
+
+ /* Run the application. */
+ main_loop(platform);
+ }
+
+ /* This is unreachable without errors. */
+ info("program terminating...\n");
+
+ /* Release platform. */
+ hal_platform_release(&platform);
+ return 0;
+}
+
diff --git a/source/application/main/Mfcc.cc b/source/application/main/Mfcc.cc
new file mode 100644
index 0000000..bf16159
--- /dev/null
+++ b/source/application/main/Mfcc.cc
@@ -0,0 +1,354 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "Mfcc.hpp"
+
+#include "PlatformMath.hpp"
+
+#include <cfloat>
+
+namespace arm {
+namespace app {
+namespace audio {
+
+ MfccParams::MfccParams(
+ const float samplingFreq,
+ const uint32_t numFbankBins,
+ const float melLoFreq,
+ const float melHiFreq,
+ const uint32_t numMfccFeats,
+ const uint32_t frameLen,
+ const bool useHtkMethod):
+ m_samplingFreq(samplingFreq),
+ m_numFbankBins(numFbankBins),
+ m_melLoFreq(melLoFreq),
+ m_melHiFreq(melHiFreq),
+ m_numMfccFeatures(numMfccFeats),
+ m_frameLen(frameLen),
+
+ /* Smallest power of 2 >= frame length. */
+ m_frameLenPadded(pow(2, ceil((log(frameLen)/log(2))))),
+ m_useHtkMethod(useHtkMethod)
+ {}
+
+ std::string MfccParams::Str()
+ {
+ char strC[1024];
+ snprintf(strC, sizeof(strC) - 1, "\n \
+ \n\t Sampling frequency: %f\
+ \n\t Number of filter banks: %u\
+ \n\t Mel frequency limit (low): %f\
+ \n\t Mel frequency limit (high): %f\
+ \n\t Number of MFCC features: %u\
+ \n\t Frame length: %u\
+ \n\t Padded frame length: %u\
+ \n\t Using HTK for Mel scale: %s\n",
+ this->m_samplingFreq, this->m_numFbankBins, this->m_melLoFreq,
+ this->m_melHiFreq, this->m_numMfccFeatures, this->m_frameLen,
+ this->m_frameLenPadded, this->m_useHtkMethod ? "yes" : "no");
+ return std::string{strC};
+ }
+
+ MFCC::MFCC(const MfccParams& params):
+ _m_params(params),
+ _m_filterBankInitialised(false)
+ {
+ this->_m_buffer = std::vector<float>(
+ this->_m_params.m_frameLenPadded, 0.0);
+ this->_m_frame = std::vector<float>(
+ this->_m_params.m_frameLenPadded, 0.0);
+ this->_m_melEnergies = std::vector<float>(
+ this->_m_params.m_numFbankBins, 0.0);
+
+ this->_m_windowFunc = std::vector<float>(this->_m_params.m_frameLen);
+ const float multiplier = 2 * M_PI / this->_m_params.m_frameLen;
+
+ /* Create window function. */
+ for (size_t i = 0; i < this->_m_params.m_frameLen; i++) {
+ this->_m_windowFunc[i] = (0.5 - (0.5 *
+ math::MathUtils::CosineF32(static_cast<float>(i) * multiplier)));
+ }
+
+ math::MathUtils::FftInitF32(this->_m_params.m_frameLenPadded, this->_m_fftInstance);
+ debug("Instantiated MFCC object: %s\n", this->_m_params.Str().c_str());
+ }
+
+ void MFCC::Init()
+ {
+ this->_InitMelFilterBank();
+ }
+
+ float MFCC::MelScale(const float freq, const bool useHTKMethod)
+ {
+ if (useHTKMethod) {
+ return 1127.0f * logf (1.0f + freq / 700.0f);
+ } else {
+ /* Slaney formula for mel scale. */
+
+ float mel = freq / ms_freqStep;
+
+ if (freq >= ms_minLogHz) {
+ mel = ms_minLogMel + logf(freq / ms_minLogHz) / ms_logStep;
+ }
+ return mel;
+ }
+ }
+
+ float MFCC::InverseMelScale(const float melFreq, const bool useHTKMethod)
+ {
+ if (useHTKMethod) {
+ return 700.0f * (expf (melFreq / 1127.0f) - 1.0f);
+ } else {
+ /* Slaney formula for mel scale. */
+ float freq = ms_freqStep * melFreq;
+
+ if (melFreq >= ms_minLogMel) {
+ freq = ms_minLogHz * expf(ms_logStep * (melFreq - ms_minLogMel));
+ }
+ return freq;
+ }
+ }
+
+
+ bool MFCC::ApplyMelFilterBank(
+ std::vector<float>& fftVec,
+ std::vector<std::vector<float>>& melFilterBank,
+ std::vector<int32_t>& filterBankFilterFirst,
+ std::vector<int32_t>& filterBankFilterLast,
+ std::vector<float>& melEnergies)
+ {
+ const size_t numBanks = melEnergies.size();
+
+ if (numBanks != filterBankFilterFirst.size() ||
+ numBanks != filterBankFilterLast.size()) {
+ printf_err("unexpected filter bank lengths\n");
+ return false;
+ }
+
+ for (size_t bin = 0; bin < numBanks; ++bin) {
+ auto filterBankIter = melFilterBank[bin].begin();
+ float melEnergy = FLT_MIN; /* Avoid log of zero at later stages */
+ int32_t firstIndex = filterBankFilterFirst[bin];
+ int32_t lastIndex = filterBankFilterLast[bin];
+
+ for (int i = firstIndex; i <= lastIndex; i++) {
+ float energyRep = math::MathUtils::SqrtF32(fftVec[i]);
+ melEnergy += (*filterBankIter++ * energyRep);
+ }
+
+ melEnergies[bin] = melEnergy;
+ }
+
+ return true;
+ }
+
+ void MFCC::ConvertToLogarithmicScale(std::vector<float>& melEnergies)
+ {
+ for (size_t bin = 0; bin < melEnergies.size(); ++bin) {
+ melEnergies[bin] = logf(melEnergies[bin]);
+ }
+ }
+
+ void MFCC::_ConvertToPowerSpectrum()
+ {
+ const uint32_t halfDim = this->_m_params.m_frameLenPadded / 2;
+
+ /* Handle this special case. */
+ float firstEnergy = this->_m_buffer[0] * this->_m_buffer[0];
+ float lastEnergy = this->_m_buffer[1] * this->_m_buffer[1];
+
+ math::MathUtils::ComplexMagnitudeSquaredF32(
+ this->_m_buffer.data(),
+ this->_m_buffer.size(),
+ this->_m_buffer.data(),
+ this->_m_buffer.size()/2);
+
+ this->_m_buffer[0] = firstEnergy;
+ this->_m_buffer[halfDim] = lastEnergy;
+ }
+
+ std::vector<float> MFCC::CreateDCTMatrix(
+ const int32_t inputLength,
+ const int32_t coefficientCount)
+ {
+ std::vector<float> dctMatix(inputLength * coefficientCount);
+
+ const float normalizer = math::MathUtils::SqrtF32(2.0f/inputLength);
+ const float angleIncr = M_PI/inputLength;
+ float angle = 0;
+
+ for (int32_t k = 0, m = 0; k < coefficientCount; k++, m += inputLength) {
+ for (int32_t n = 0; n < inputLength; n++) {
+ dctMatix[m+n] = normalizer *
+ math::MathUtils::CosineF32((n + 0.5) * angle);
+ }
+ angle += angleIncr;
+ }
+
+ return dctMatix;
+ }
+
+ float MFCC::GetMelFilterBankNormaliser(
+ const float& leftMel,
+ const float& rightMel,
+ const bool useHTKMethod)
+ {
+ UNUSED(leftMel);
+ UNUSED(rightMel);
+ UNUSED(useHTKMethod);
+
+ /* By default, no normalisation => return 1 */
+ return 1.f;
+ }
+
+ void MFCC::_InitMelFilterBank()
+ {
+ if (!this->_IsMelFilterBankInited()) {
+ this->_m_melFilterBank = this->_CreateMelFilterBank();
+ this->_m_dctMatrix = this->CreateDCTMatrix(
+ this->_m_params.m_numFbankBins,
+ this->_m_params.m_numMfccFeatures);
+ this->_m_filterBankInitialised = true;
+ }
+ }
+
+ bool MFCC::_IsMelFilterBankInited()
+ {
+ return this->_m_filterBankInitialised;
+ }
+
+ void MFCC::_MfccComputePreFeature(const std::vector<int16_t>& audioData)
+ {
+ this->_InitMelFilterBank();
+
+ /* TensorFlow way of normalizing .wav data to (-1, 1). */
+ constexpr float normaliser = 1.0/(1<<15);
+ for (size_t i = 0; i < this->_m_params.m_frameLen; i++) {
+ this->_m_frame[i] = static_cast<float>(audioData[i]) * normaliser;
+ }
+
+ /* Apply window function to input frame. */
+ for(size_t i = 0; i < this->_m_params.m_frameLen; i++) {
+ this->_m_frame[i] *= this->_m_windowFunc[i];
+ }
+
+ /* Set remaining frame values to 0. */
+ std::fill(this->_m_frame.begin() + this->_m_params.m_frameLen,this->_m_frame.end(), 0);
+
+ /* Compute FFT. */
+ math::MathUtils::FftF32(this->_m_frame, this->_m_buffer, this->_m_fftInstance);
+
+ /* Convert to power spectrum. */
+ this->_ConvertToPowerSpectrum();
+
+ /* Apply mel filterbanks. */
+ if (!this->ApplyMelFilterBank(this->_m_buffer,
+ this->_m_melFilterBank,
+ this->_m_filterBankFilterFirst,
+ this->_m_filterBankFilterLast,
+ this->_m_melEnergies)) {
+ printf_err("Failed to apply MEL filter banks\n");
+ }
+
+ /* Convert to logarithmic scale. */
+ this->ConvertToLogarithmicScale(this->_m_melEnergies);
+ }
+
+ std::vector<float> MFCC::MfccCompute(const std::vector<int16_t>& audioData)
+ {
+ this->_MfccComputePreFeature(audioData);
+
+ std::vector<float> mfccOut(this->_m_params.m_numMfccFeatures);
+
+ float * ptrMel = this->_m_melEnergies.data();
+ float * ptrDct = this->_m_dctMatrix.data();
+ float * ptrMfcc = mfccOut.data();
+
+ /* Take DCT. Uses matrix mul. */
+ for (size_t i = 0, j = 0; i < mfccOut.size();
+ ++i, j += this->_m_params.m_numFbankBins) {
+ *ptrMfcc++ = math::MathUtils::DotProductF32(
+ ptrDct + j,
+ ptrMel,
+ this->_m_params.m_numFbankBins);
+ }
+ return mfccOut;
+ }
+
+ std::vector<std::vector<float>> MFCC::_CreateMelFilterBank()
+ {
+ size_t numFftBins = this->_m_params.m_frameLenPadded / 2;
+ float fftBinWidth = static_cast<float>(this->_m_params.m_samplingFreq) / this->_m_params.m_frameLenPadded;
+
+ float melLowFreq = MFCC::MelScale(this->_m_params.m_melLoFreq,
+ this->_m_params.m_useHtkMethod);
+ float melHighFreq = MFCC::MelScale(this->_m_params.m_melHiFreq,
+ this->_m_params.m_useHtkMethod);
+ float melFreqDelta = (melHighFreq - melLowFreq) / (this->_m_params.m_numFbankBins + 1);
+
+ std::vector<float> thisBin = std::vector<float>(numFftBins);
+ std::vector<std::vector<float>> melFilterBank(
+ this->_m_params.m_numFbankBins);
+ this->_m_filterBankFilterFirst =
+ std::vector<int32_t>(this->_m_params.m_numFbankBins);
+ this->_m_filterBankFilterLast =
+ std::vector<int32_t>(this->_m_params.m_numFbankBins);
+
+ for (size_t bin = 0; bin < this->_m_params.m_numFbankBins; bin++) {
+ float leftMel = melLowFreq + bin * melFreqDelta;
+ float centerMel = melLowFreq + (bin + 1) * melFreqDelta;
+ float rightMel = melLowFreq + (bin + 2) * melFreqDelta;
+
+ int32_t firstIndex = -1;
+ int32_t lastIndex = -1;
+ const float normaliser = this->GetMelFilterBankNormaliser(leftMel, rightMel, this->_m_params.m_useHtkMethod);
+
+ for (size_t i = 0; i < numFftBins; i++) {
+ float freq = (fftBinWidth * i); /* Center freq of this fft bin. */
+ float mel = MFCC::MelScale(freq, this->_m_params.m_useHtkMethod);
+ thisBin[i] = 0.0;
+
+ if (mel > leftMel && mel < rightMel) {
+ float weight;
+ if (mel <= centerMel) {
+ weight = (mel - leftMel) / (centerMel - leftMel);
+ } else {
+ weight = (rightMel - mel) / (rightMel - centerMel);
+ }
+
+ thisBin[i] = weight * normaliser;
+ if (firstIndex == -1) {
+ firstIndex = i;
+ }
+ lastIndex = i;
+ }
+ }
+
+ this->_m_filterBankFilterFirst[bin] = firstIndex;
+ this->_m_filterBankFilterLast[bin] = lastIndex;
+
+ /* Copy the part we care about. */
+ for (int32_t i = firstIndex; i <= lastIndex; i++) {
+ melFilterBank[bin].push_back(thisBin[i]);
+ }
+ }
+
+ return melFilterBank;
+ }
+
+} /* namespace audio */
+} /* namespace app */
+} /* namespace arm */
diff --git a/source/application/main/PlatformMath.cc b/source/application/main/PlatformMath.cc
new file mode 100644
index 0000000..a9f5049
--- /dev/null
+++ b/source/application/main/PlatformMath.cc
@@ -0,0 +1,196 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "PlatformMath.hpp"
+
+#if 0 == ARM_DSP_AVAILABLE
+ #include <cmath>
+ #include <numeric>
+#endif /* 0 == ARM_DSP_AVAILABLE */
+
+namespace arm {
+namespace app {
+namespace math {
+
+ float MathUtils::CosineF32(float radians)
+ {
+#if ARM_DSP_AVAILABLE
+ return arm_cos_f32(radians);
+#else /* ARM_DSP_AVAILABLE */
+ return cos(radians);
+#endif /* ARM_DSP_AVAILABLE */
+ }
+
+ float MathUtils::SqrtF32(float input)
+ {
+#if ARM_DSP_AVAILABLE
+ float output = 0.f;
+ arm_sqrt_f32(input, &output);
+ return output;
+#else /* ARM_DSP_AVAILABLE */
+ return sqrtf(input);
+#endif /* ARM_DSP_AVAILABLE */
+ }
+
+ float MathUtils::MeanF32(float* ptrSrc, const uint32_t srcLen)
+ {
+ if (!srcLen) {
+ return 0.f;
+ }
+
+#if ARM_DSP_AVAILABLE
+ float result = 0.f;
+ arm_mean_f32(ptrSrc, srcLen, &result);
+ return result;
+#else /* ARM_DSP_AVAILABLE */
+ float acc = std::accumulate(ptrSrc, ptrSrc + srcLen, 0.0);
+ return acc/srcLen;
+#endif /* ARM_DSP_AVAILABLE */
+ }
+
+ float MathUtils::StdDevF32(float* ptrSrc, const uint32_t srcLen,
+ const float mean)
+ {
+ if (!srcLen) {
+ return 0.f;
+ }
+#if ARM_DSP_AVAILABLE
+ /**
+ * Note Standard deviation calculation can be off
+ * by > 0.01 but less than < 0.1, according to
+ * preliminary findings.
+ **/
+ UNUSED(mean);
+ float stdDev = 0;
+ arm_std_f32(ptrSrc, srcLen, &stdDev);
+ return stdDev;
+#else /* ARM_DSP_AVAILABLE */
+ auto VarianceFunction = [=](float acc, const float value) {
+ return acc + (((value - mean) * (value - mean))/ srcLen);
+ };
+
+ float acc = std::accumulate(ptrSrc, ptrSrc + srcLen, 0.0,
+ VarianceFunction);
+
+ return sqrtf(acc);
+#endif /* ARM_DSP_AVAILABLE */
+ }
+
+ bool MathUtils::FftInitF32(const uint16_t fftLen, arm::app::math::FftInstance& fftInstance)
+ {
+#if ARM_DSP_AVAILABLE
+ if (!fftInstance.initialised) {
+ arm_status status = arm_rfft_fast_init_f32(&fftInstance.instance, fftLen);
+
+ if (ARM_MATH_SUCCESS != status) {
+ return false;
+ }
+ fftInstance.initialised = true;
+ }
+#else
+ UNUSED(fftLen);
+ UNUSED(fftInstance);
+#endif /* ARM_DSP_AVAILABLE */
+ return true;
+ }
+
+ void MathUtils::FftF32(std::vector<float>& input,
+ std::vector<float>& fftOutput,
+ arm::app::math::FftInstance& fftInstance)
+ {
+#if ARM_DSP_AVAILABLE
+ arm_rfft_fast_f32(&fftInstance.instance, input.data(), fftOutput.data(), 0);
+#else
+ UNUSED(fftInstance);
+ const int inputLength = input.size();
+
+ for (int k = 0; k <= inputLength / 2; k++) {
+ float sumReal = 0, sumImag = 0;
+
+ for (int t = 0; t < inputLength; t++) {
+ float angle = 2 * M_PI * t * k / inputLength;
+ sumReal += input[t] * cosf(angle);
+ sumImag += -input[t] * sinf(angle);
+ }
+
+ /* Arrange output to [real0, realN/2, real1, im1, real2, im2, ...] */
+ if (k == 0) {
+ fftOutput[0] = sumReal;
+ } else if (k == inputLength / 2) {
+ fftOutput[1] = sumReal;
+ } else {
+ fftOutput[k*2] = sumReal;
+ fftOutput[k*2 + 1] = sumImag;
+ };
+ }
+#endif /* ARM_DSP_AVAILABLE */
+ }
+
+ void MathUtils::VecLogarithmF32(std::vector <float>& input,
+ std::vector <float>& output)
+ {
+#if ARM_DSP_AVAILABLE
+ arm_vlog_f32(input.data(), output.data(),
+ output.size());
+#else /* ARM_DSP_AVAILABLE */
+ for (auto in = input.begin(), out = output.begin();
+ in != input.end(); ++in, ++out) {
+ *out = logf(*in);
+ }
+#endif /* ARM_DSP_AVAILABLE */
+ }
+
+ float MathUtils::DotProductF32(float* srcPtrA, float* srcPtrB,
+ const uint32_t srcLen)
+ {
+ float output = 0.f;
+
+#if ARM_DSP_AVAILABLE
+ arm_dot_prod_f32(srcPtrA, srcPtrB, srcLen, &output);
+#else /* ARM_DSP_AVAILABLE */
+ for (uint32_t i = 0; i < srcLen; ++i) {
+ output += *srcPtrA++ * *srcPtrB++;
+ }
+#endif /* ARM_DSP_AVAILABLE */
+
+ return output;
+ }
+
+ bool MathUtils::ComplexMagnitudeSquaredF32(float* ptrSrc,
+ const uint32_t srcLen,
+ float* ptrDst,
+ const uint32_t dstLen)
+ {
+ if (dstLen < srcLen/2) {
+ printf_err("dstLen must be greater than srcLen/2");
+ return false;
+ }
+
+#if ARM_DSP_AVAILABLE
+ arm_cmplx_mag_squared_f32(ptrSrc, ptrDst, srcLen/2);
+#else /* ARM_DSP_AVAILABLE */
+ for (uint32_t j = 0; j < srcLen; ++j) {
+ const float real = *ptrSrc++;
+ const float im = *ptrSrc++;
+ *ptrDst++ = real*real + im*im;
+ }
+#endif /* ARM_DSP_AVAILABLE */
+ return true;
+ }
+
+} /* namespace math */
+} /* namespace app */
+} /* namespace arm */ \ No newline at end of file
diff --git a/source/application/main/Profiler.cc b/source/application/main/Profiler.cc
new file mode 100644
index 0000000..f364759
--- /dev/null
+++ b/source/application/main/Profiler.cc
@@ -0,0 +1,219 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "Profiler.hpp"
+
+#include <cstring>
+#include <string>
+#include <sstream>
+
+namespace arm {
+namespace app {
+
+ template<class T>
+ static void writeStatLine(std::ostringstream& s,
+ const char* desc,
+ T total,
+ uint32_t samples,
+ T min,
+ T max)
+ {
+ s << "\t" << desc << total << " / "
+ << ((double)total / samples) << " / "
+ << min << " / " << max << std::endl;
+ }
+
+ Profiler::Profiler(hal_platform* platform, const char* name = "Unknown")
+ : _m_name(name)
+ {
+ if (platform && platform->inited) {
+ this->_m_pPlatform = platform;
+ this->Reset();
+ } else {
+ printf_err("Profiler %s initialised with invalid platform\n",
+ this->_m_name.c_str());
+ }
+ }
+
+ bool Profiler::StartProfiling(const char* name)
+ {
+ if (name) {
+ this->SetName(name);
+ }
+ if (this->_m_pPlatform && !this->_m_started) {
+ this->_m_pPlatform->timer->reset();
+ this->_m_tstampSt = this->_m_pPlatform->timer->start_profiling();
+ this->_m_started = true;
+ return true;
+ }
+ printf_err("Failed to start profiler %s\n", this->_m_name.c_str());
+ return false;
+ }
+
+ bool Profiler::StopProfiling()
+ {
+ if (this->_m_pPlatform && this->_m_started) {
+ this->_m_tstampEnd = this->_m_pPlatform->timer->stop_profiling();
+ this->_m_started = false;
+
+ this->_AddProfilingUnit(this->_m_tstampSt, this->_m_tstampEnd, this->_m_name);
+
+ return true;
+ }
+ printf_err("Failed to stop profiler %s\n", this->_m_name.c_str());
+ return false;
+ }
+
+ bool Profiler::StopProfilingAndReset()
+ {
+ if (this->StopProfiling()) {
+ this->Reset();
+ return true;
+ }
+ printf_err("Failed to stop profiler %s\n", this->_m_name.c_str());
+ return false;
+ }
+
+ void Profiler::Reset()
+ {
+ this->_m_started = false;
+ memset(&this->_m_tstampSt, 0, sizeof(this->_m_tstampSt));
+ memset(&this->_m_tstampEnd, 0, sizeof(this->_m_tstampEnd));
+ }
+
+ std::string Profiler::GetResultsAndReset()
+ {
+ std::ostringstream strResults;
+
+ for (const auto& item: this->_m_series) {
+ auto name = item.first;
+ ProfilingSeries series = item.second;
+
+ uint32_t samplesNum = series.size();
+
+ uint64_t totalNpuCycles = 0; /* Total NPU cycles (idle + active). */
+ uint64_t totalActiveNpuCycles = 0; /* Active NPU cycles. */
+ uint64_t totalCpuCycles = 0; /* Total CPU cycles. */
+ time_t totalTimeMs = 0;
+
+ uint64_t minActiveNpuCycles = series[0].activeNpuCycles;
+ uint64_t minIdleNpuCycles = series[0].npuCycles - minActiveNpuCycles;
+ uint64_t minActiveCpuCycles = series[0].cpuCycles - minActiveNpuCycles;
+ time_t minTimeMs = series[0].time;
+
+ uint64_t maxIdleNpuCycles = 0;
+ uint64_t maxActiveNpuCycles = 0;
+ uint64_t maxActiveCpuCycles = 0;
+ time_t maxTimeMs = 0;
+
+ for(ProfilingUnit& unit: series){
+ totalNpuCycles += unit.npuCycles;
+ totalActiveNpuCycles += unit.activeNpuCycles;
+ totalCpuCycles += unit.cpuCycles;
+ totalTimeMs += unit.time;
+
+ maxActiveNpuCycles = std::max(maxActiveNpuCycles,
+ unit.activeNpuCycles);
+ maxIdleNpuCycles = std::max(maxIdleNpuCycles,
+ unit.npuCycles - maxActiveNpuCycles);
+ maxActiveCpuCycles = std::max(maxActiveCpuCycles,
+ unit.cpuCycles - maxActiveNpuCycles);
+ maxTimeMs = std::max(maxTimeMs, unit.time);
+
+ minActiveNpuCycles = std::min(minActiveNpuCycles,
+ unit.activeNpuCycles);
+ minIdleNpuCycles = std::min(minIdleNpuCycles,
+ unit.npuCycles - minActiveNpuCycles);
+ minActiveCpuCycles = std::min(minActiveCpuCycles,
+ unit.cpuCycles - minActiveNpuCycles);
+ minTimeMs = std::min(minTimeMs, unit.time);
+ }
+
+ strResults << "Profile for " << name << ": " << std::endl;
+
+ if (samplesNum > 1) {
+ strResults << "\tSamples: " << samplesNum << std::endl;
+ strResults << "\t Total / Avg./ Min / Max"
+ << std::endl;
+
+ writeStatLine<uint64_t>(strResults, "Active NPU cycles: ",
+ totalActiveNpuCycles, samplesNum,
+ minActiveNpuCycles, maxActiveNpuCycles);
+
+ writeStatLine<uint64_t>(strResults, "Idle NPU cycles: ",
+ (totalNpuCycles - totalActiveNpuCycles),
+ samplesNum, minIdleNpuCycles, maxIdleNpuCycles);
+
+#if defined(CPU_PROFILE_ENABLED)
+ writeStatLine<uint64_t>(strResults, "Active CPU cycles (approx): ",
+ (totalCpuCycles - totalActiveNpuCycles),
+ samplesNum, minActiveCpuCycles,
+ maxActiveCpuCycles);
+
+ writeStatLine<time_t>(strResults, "Time in ms: ",
+ totalTimeMs, samplesNum, minTimeMs, maxTimeMs);
+#endif
+ } else {
+ strResults << "\tActive NPU cycles: " << totalActiveNpuCycles
+ << std::endl;
+ strResults << "\tIdle NPU cycles: "
+ << (totalNpuCycles - totalActiveNpuCycles)
+ << std::endl;
+#if defined(CPU_PROFILE_ENABLED)
+ strResults << "\tActive CPU cycles: "
+ << (totalCpuCycles - totalActiveNpuCycles)
+ << " (approx)" << std::endl;
+
+ strResults << "\tTime in ms: " << totalTimeMs << std::endl;
+#endif
+ }
+ }
+ this->Reset();
+ return strResults.str();
+ }
+
+ void Profiler::SetName(const char* str)
+ {
+ this->_m_name = std::string(str);
+ }
+
+ void Profiler::_AddProfilingUnit(time_counter start, time_counter end,
+ const std::string& name)
+ {
+ platform_timer * timer = this->_m_pPlatform->timer;
+
+ struct ProfilingUnit unit;
+
+ if (timer->cap.npu_cycles && timer->get_npu_total_cycle_diff &&
+ timer->get_npu_active_cycle_diff)
+ {
+ unit.npuCycles = timer->get_npu_total_cycle_diff(&start, &end);
+ unit.activeNpuCycles = timer->get_npu_active_cycle_diff(&start, &end);
+ }
+
+ if (timer->cap.cpu_cycles && timer->get_cpu_cycle_diff) {
+ unit.cpuCycles = timer->get_cpu_cycle_diff(&start, &end);
+ }
+
+ if (timer->cap.duration_ms && timer->get_duration_ms) {
+ unit.time = timer->get_duration_ms(&start, &end);
+ }
+
+ this->_m_series[name].emplace_back(unit);
+ }
+
+} /* namespace app */
+} /* namespace arm */ \ No newline at end of file
diff --git a/source/application/main/UseCaseCommonUtils.cc b/source/application/main/UseCaseCommonUtils.cc
new file mode 100644
index 0000000..4ea5e4d
--- /dev/null
+++ b/source/application/main/UseCaseCommonUtils.cc
@@ -0,0 +1,119 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "UseCaseCommonUtils.hpp"
+
+#include "InputFiles.hpp"
+
+namespace arm {
+namespace app {
+
+ bool RunInference(hal_platform& platform, arm::app::Model& model)
+ {
+ Profiler profiler{&platform, "Inference"};
+ profiler.StartProfiling();
+
+ bool runInf = model.RunInference();
+
+ profiler.StopProfiling();
+ std::string profileResults = profiler.GetResultsAndReset();
+ info("%s\n", profileResults.c_str());
+
+ return runInf;
+ }
+
+ int ReadUserInputAsInt(hal_platform& platform)
+ {
+ char chInput[128];
+ memset(chInput, 0, sizeof(chInput));
+
+ platform.data_acq->get_input(chInput, sizeof(chInput));
+ return atoi(chInput);
+ }
+
+ void DumpTensor(TfLiteTensor* tensor, const size_t lineBreakForNumElements)
+ {
+ char strhex[8];
+ std::string strdump;
+
+ if (!tensor) {
+ printf_err("invalid tensor\n");
+ return;
+ }
+
+ const uint32_t tensorSz = tensor->bytes;
+ const uint8_t* tensorData = tflite::GetTensorData<uint8_t>(tensor);
+
+ for (size_t i = 0; i < tensorSz; ++i) {
+ if (0 == i % lineBreakForNumElements) {
+ printf("%s\n\t", strdump.c_str());
+ strdump.clear();
+ }
+ snprintf(strhex, sizeof(strhex) - 1,
+ "0x%02x, ", tensorData[i]);
+ strdump += std::string(strhex);
+ }
+
+ if (strdump.size()) {
+ printf("%s\n", strdump.c_str());
+ }
+ }
+
+ bool ListFilesHandler(ApplicationContext& ctx)
+ {
+ auto& model = ctx.Get<Model&>("model");
+ auto& platform = ctx.Get<hal_platform&>("platform");
+
+ constexpr uint32_t dataPsnTxtStartX = 20;
+ constexpr uint32_t dataPsnTxtStartY = 40;
+
+ if (!model.IsInited()) {
+ printf_err("Model is not initialised! Terminating processing.\n");
+ return false;
+ }
+
+ /* Clear the LCD */
+ platform.data_psn->clear(COLOR_BLACK);
+
+ /* Show the total number of embedded files. */
+ std::string strNumFiles = std::string{"Total Number of Files: "} +
+ std::to_string(NUMBER_OF_FILES);
+ platform.data_psn->present_data_text(strNumFiles.c_str(),
+ strNumFiles.size(),
+ dataPsnTxtStartX,
+ dataPsnTxtStartY,
+ 0);
+
+#if NUMBER_OF_FILES > 0
+ constexpr uint32_t dataPsnTxtYIncr = 16;
+ info("List of Files:\n");
+ uint32_t yVal = dataPsnTxtStartY + dataPsnTxtYIncr;
+ for (uint32_t i = 0; i < NUMBER_OF_FILES; ++i, yVal += dataPsnTxtYIncr) {
+
+ std::string currentFilename{get_filename(i)};
+ platform.data_psn->present_data_text(currentFilename.c_str(),
+ currentFilename.size(),
+ dataPsnTxtStartX, yVal, 0);
+
+ info("\t%u => %s\n", i, currentFilename.c_str());
+ }
+#endif /* NUMBER_OF_FILES > 0 */
+
+ return true;
+ }
+
+} /* namespace app */
+} /* namespace arm */ \ No newline at end of file
diff --git a/source/application/main/include/AppContext.hpp b/source/application/main/include/AppContext.hpp
new file mode 100644
index 0000000..588dfaa
--- /dev/null
+++ b/source/application/main/include/AppContext.hpp
@@ -0,0 +1,102 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef APP_CTX_HPP
+#define APP_CTX_HPP
+
+#include <string>
+#include <map>
+
+namespace arm {
+namespace app {
+
+ class IAttribute
+ {
+ public:
+ virtual ~IAttribute() = default;
+ };
+
+ template<typename T>
+ class Attribute : public IAttribute
+ {
+ public:
+ ~Attribute() override = default;
+
+ explicit Attribute(const T value): _m_value(value){}
+
+ T Get()
+ {
+ return _m_value;
+ }
+ private:
+ T _m_value;
+ };
+
+ /* Application context class */
+ class ApplicationContext {
+ public:
+
+ /**
+ * @brief Saves given value as a named attribute in the context.
+ * @tparam T value type.
+ * @param[in] name Context attribute name.
+ * @param[in] object Value to save in the context.
+ */
+ template<typename T>
+ void Set(const std::string &name, T object)
+ {
+ this->_m_attributes[name] = new Attribute<T>(object);
+ }
+
+ /**
+ * @brief Gets the saved attribute from the context by the given name.
+ * @tparam T value type.
+ * @param[in] name Context attribute name.
+ * @return Value saved in the context.
+ */
+ template<typename T>
+ T Get(const std::string &name)
+ {
+ auto a = (Attribute<T>*)_m_attributes[name];
+ return a->Get();
+ }
+
+ /**
+ * @brief Checks if an attribute for a given name exists in the context.
+ * @param[in] name Attribute name.
+ * @return true if attribute exists, false otherwise
+ */
+ bool Has(const std::string& name)
+ {
+ return _m_attributes.find(name) != _m_attributes.end();
+ }
+
+ ApplicationContext() = default;
+
+ ~ApplicationContext() {
+ for (auto& attribute : _m_attributes)
+ delete attribute.second;
+
+ this->_m_attributes.clear();
+ }
+ private:
+ std::map<std::string, IAttribute*> _m_attributes;
+ };
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* APP_CTX_HPP */
diff --git a/source/application/main/include/AudioUtils.hpp b/source/application/main/include/AudioUtils.hpp
new file mode 100644
index 0000000..cba981d
--- /dev/null
+++ b/source/application/main/include/AudioUtils.hpp
@@ -0,0 +1,171 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef AUDIO_UTILS_HPP
+#define AUDIO_UTILS_HPP
+
+#include <cstddef>
+#include <cstdint>
+
+namespace arm {
+namespace app {
+namespace audio {
+
+ template<class T>
+ class SlidingWindow {
+ public:
+
+ /**
+ * @brief Creates the window slider through the given data.
+ *
+ * @param[in] data Pointer to the data to slide through.
+ * @param[in] dataSize Size in T type elements wise.
+ * @param[in] windowSize Sliding window size in T type wise elements.
+ * @param[in] stride Stride size in T type wise elements.
+ */
+ SlidingWindow(T *data, size_t dataSize,
+ size_t windowSize, size_t stride) {
+ m_start = data;
+ m_dataSize = dataSize;
+ m_size = windowSize;
+ m_stride = stride;
+ }
+
+ SlidingWindow() = default;
+
+ ~SlidingWindow() = default;
+
+ /**
+ * @brief Get the next data window.
+ * @return Pointer to the next window, if next window is not available nullptr is returned.
+ */
+ virtual T *Next() {
+ if (HasNext()) {
+ m_count++;
+ return m_start + Index() * m_stride;
+ } else {
+ return nullptr;
+ }
+ }
+
+ /**
+ * @brief Checks if the next data portion is available.
+ * @return true if next data portion is available.
+ */
+ virtual bool HasNext() {
+ return m_size + m_count * m_stride <= m_dataSize;
+ }
+
+ /**
+ * @brief Reset the slider to the initial position.
+ */
+ virtual void Reset() {
+ m_count = 0;
+ }
+
+ /**
+ * @brief Resets the slider to the start of the new data.
+ * New data size MUST be the same as the old one.
+ * @param[in] newStart Pointer to the new data to slide through.
+ */
+ virtual void Reset(T *newStart) {
+ m_start = newStart;
+ Reset();
+ }
+
+ /**
+ * @brief Gets current index of the sliding window.
+ * @return Current position of the sliding window in number of strides.
+ */
+ size_t Index() {
+ return m_count == 0? 0: m_count - 1;
+ }
+
+ /**
+ * @brief Gets the index from the start of the data where the next window will begin.
+ * While Index() returns the index of sliding window itself this function
+ * returns the index of the data element itself.
+ * @return Index from the start of the data where the next sliding window will begin.
+ */
+ virtual uint32_t NextWindowStartIndex() {
+ return m_count == 0? 0: ((m_count) * m_stride);
+ }
+
+ /**
+ * @brief Go to given sliding window index.
+ * @param[in] index New position of the sliding window. If index is invalid
+ * (greater than possible range of strides) then next call to Next() will return nullptr.
+ */
+ void FastForward(size_t index) {
+ m_count = index;
+ }
+
+ /**
+ * @brief Calculates whole number of times the window can stride through the given data.
+ * @return Maximum number of whole strides.
+ */
+ size_t TotalStrides() {
+ if (m_size > m_dataSize) {
+ return 0;
+ }
+ return ((m_dataSize - m_size)/m_stride);
+ }
+
+ /**
+ * @brief Calculates number of times the window can stride through the given data.
+ * May not be a whole number.
+ * @return Number of strides to cover all data.
+ */
+ float FractionalTotalStrides() {
+ if (this->m_dataSize < this->m_size) {
+ return 0;
+ } else {
+ return ((this->m_dataSize - this->m_size)/ static_cast<float>(this->m_stride));
+ }
+ }
+
+ protected:
+ T *m_start = nullptr;
+ size_t m_dataSize = 0;
+ size_t m_size = 0;
+ size_t m_stride = 0;
+ size_t m_count = 0;
+ };
+
+ /*
+ * Sliding window for ASR will cover the whole of the input, even if
+ * this means the last window is not a full window length.
+ */
+ template<class T>
+ class ASRSlidingWindow : public SlidingWindow<T> {
+ public:
+ using SlidingWindow<T>::SlidingWindow;
+
+ /**
+ * @brief Checks if the next data portion is available.
+ * @return true if next data portion is available.
+ */
+ bool HasNext() {
+ return this->m_count < 1 + this->FractionalTotalStrides() && (this->NextWindowStartIndex() < this->m_dataSize);
+ }
+ };
+
+
+} /* namespace audio */
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* AUDIO_UTILS_HPP */ \ No newline at end of file
diff --git a/source/application/main/include/ClassificationResult.hpp b/source/application/main/include/ClassificationResult.hpp
new file mode 100644
index 0000000..eae28e4
--- /dev/null
+++ b/source/application/main/include/ClassificationResult.hpp
@@ -0,0 +1,41 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef CLASSIFICATION_RESULT_HPP
+#define CLASSIFICATION_RESULT_HPP
+
+#include <string>
+
+namespace arm {
+namespace app {
+
+ /**
+ * @brief Class representing a single classification result.
+ */
+ class ClassificationResult {
+ public:
+ double m_normalisedVal = 0.0;
+ std::string m_label;
+ uint32_t m_labelIdx = 0;
+
+ ClassificationResult() = default;
+ ~ClassificationResult() = default;
+ };
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* CLASSIFICATION_RESULT_HPP */ \ No newline at end of file
diff --git a/source/application/main/include/Classifier.hpp b/source/application/main/include/Classifier.hpp
new file mode 100644
index 0000000..510e6f9
--- /dev/null
+++ b/source/application/main/include/Classifier.hpp
@@ -0,0 +1,74 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef CLASSIFIER_HPP
+#define CLASSIFIER_HPP
+
+#include "ClassificationResult.hpp"
+#include "TensorFlowLiteMicro.hpp"
+
+#include <vector>
+
+namespace arm {
+namespace app {
+
+ /**
+ * @brief Classifier - a helper class to get certain number of top
+ * results from the output vector from a classification NN.
+ **/
+ class Classifier{
+ public:
+ /** @brief Constructor. */
+ Classifier() = default;
+
+ /**
+ * @brief Gets the top N classification results from the
+ * output vector.
+ * @param[in] outputTensor Inference output tensor from an NN model.
+ * @param[out] vecResults A vector of classification results.
+ * populated by this function.
+ * @param[in] labels Labels vector to match classified classes.
+ * @param[in] topNCount Number of top classifications to pick. Default is 1.
+ * @return true if successful, false otherwise.
+ **/
+ virtual bool GetClassificationResults(
+ TfLiteTensor* outputTensor,
+ std::vector<ClassificationResult>& vecResults,
+ const std::vector <std::string>& labels, uint32_t topNCount);
+
+ private:
+ /**
+ * @brief Utility function that gets the top N classification results from the
+ * output vector.
+ * @tparam T value type
+ * @param[in] tensor Inference output tensor from an NN model.
+ * @param[out] vecResults A vector of classification results
+ * populated by this function.
+ * @param[in] topNCount Number of top classifications to pick.
+ * @param[in] labels Labels vector to match classified classes.
+ * @return true if successful, false otherwise.
+ **/
+ template<typename T>
+ bool _GetTopNResults(TfLiteTensor* tensor,
+ std::vector<ClassificationResult>& vecResults,
+ uint32_t topNCount,
+ const std::vector <std::string>& labels);
+ };
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* CLASSIFIER_HPP */
diff --git a/source/application/main/include/DataStructures.hpp b/source/application/main/include/DataStructures.hpp
new file mode 100644
index 0000000..5cc8b5e
--- /dev/null
+++ b/source/application/main/include/DataStructures.hpp
@@ -0,0 +1,132 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef DATA_STRUCTURES_HPP
+#define DATA_STRUCTURES_HPP
+
+#include "hal.h"
+
+#include <iterator>
+
+namespace arm {
+namespace app {
+
+ /**
+ * Class Array2d is a data structure that represents a two dimensional array.
+ * The data is allocated in contiguous memory, arranged row-wise
+ * and individual elements can be accessed with the () operator.
+ * For example a two dimensional array D of size (M, N) can be accessed:
+ *
+ * _|<------------- col size = N -------->|
+ * | D(r=0, c=0) D(r=0, c=1)... D(r=0, c=N)
+ * | D(r=1, c=0) D(r=1, c=1)... D(r=1, c=N)
+ * | ...
+ * row size = M ...
+ * | ...
+ * _ D(r=M, c=0) D(r=M, c=1)... D(r=M, c=N)
+ *
+ */
+ template<typename T>
+ class Array2d {
+ public:
+ /**
+ * @brief Creates the array2d with the given sizes.
+ * @param[in] rows Number of rows.
+ * @param[in] cols Number of columns.
+ */
+ Array2d(unsigned rows, unsigned cols)
+ {
+ if (rows == 0 || cols == 0) {
+ printf_err("Array2d constructor has 0 size.\n");
+ _m_data = nullptr;
+ return;
+ }
+ _m_rows = rows;
+ _m_cols = cols;
+ _m_data = new T[rows * cols];
+ }
+
+ ~Array2d()
+ {
+ delete[] _m_data;
+ }
+
+ T& operator() (unsigned int row, unsigned int col)
+ {
+#if defined(DEBUG)
+ if (row >= _m_rows || col >= _m_cols || _m_data == nullptr) {
+ printf_err("Array2d subscript out of bounds.\n");
+ }
+#endif /* defined(DEBUG) */
+ return _m_data[_m_cols * row + col];
+ }
+
+ T operator() (unsigned int row, unsigned int col) const
+ {
+#if defined(DEBUG)
+ if (row >= _m_rows || col >= _m_cols || _m_data == nullptr) {
+ printf_err("const Array2d subscript out of bounds.\n");
+ }
+#endif /* defined(DEBUG) */
+ return _m_data[_m_cols * row + col];
+ }
+
+ /**
+ * @brief Gets rows number of the current array2d.
+ * @return Number of rows.
+ */
+ size_t size(size_t dim)
+ {
+ switch (dim)
+ {
+ case 0:
+ return _m_rows;
+ case 1:
+ return _m_cols;
+ default:
+ return 0;
+ }
+ }
+
+ /**
+ * @brief Gets the array2d total size.
+ */
+ size_t totalSize()
+ {
+ return _m_rows * _m_cols;
+ }
+
+ /**
+ * array2d iterator.
+ */
+ using iterator=T*;
+ using const_iterator=T const*;
+
+ iterator begin() { return _m_data; }
+ iterator end() { return _m_data + totalSize(); }
+ const_iterator begin() const { return _m_data; }
+ const_iterator end() const { return _m_data + totalSize(); };
+
+ private:
+ size_t _m_rows;
+ size_t _m_cols;
+ T* _m_data;
+ };
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* DATA_STRUCTURES_HPP */ \ No newline at end of file
diff --git a/source/application/main/include/Mfcc.hpp b/source/application/main/include/Mfcc.hpp
new file mode 100644
index 0000000..6379fab
--- /dev/null
+++ b/source/application/main/include/Mfcc.hpp
@@ -0,0 +1,255 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef MFCC_HPP
+#define MFCC_HPP
+
+#include "PlatformMath.hpp"
+
+#include <vector>
+#include <cstdint>
+#include <cmath>
+#include <limits>
+#include <string>
+
+namespace arm {
+namespace app {
+namespace audio {
+
+ /* MFCC's consolidated parameters. */
+ class MfccParams {
+ public:
+ float m_samplingFreq;
+ uint32_t m_numFbankBins;
+ float m_melLoFreq;
+ float m_melHiFreq;
+ uint32_t m_numMfccFeatures;
+ uint32_t m_frameLen;
+ uint32_t m_frameLenPadded;
+ bool m_useHtkMethod;
+
+ /** @brief Constructor */
+ MfccParams(float samplingFreq, uint32_t numFbankBins,
+ float melLoFreq, float melHiFreq,
+ uint32_t numMfccFeats, uint32_t frameLen,
+ bool useHtkMethod);
+
+ MfccParams() = delete;
+
+ ~MfccParams() = default;
+
+ /** @brief String representation of parameters */
+ std::string Str();
+ };
+
+ /**
+ * @brief Class for MFCC feature extraction.
+ * Based on https://github.com/ARM-software/ML-KWS-for-MCU/blob/master/Deployment/Source/MFCC/mfcc.cpp
+ * This class is designed to be generic and self-sufficient but
+ * certain calculation routines can be overridden to accommodate
+ * use-case specific requirements.
+ */
+ class MFCC {
+ public:
+ /**
+ * @brief Constructor
+ * @param[in] params MFCC parameters
+ */
+ explicit MFCC(const MfccParams& params);
+
+ MFCC() = delete;
+
+ ~MFCC() = default;
+
+ /**
+ * @brief Extract MFCC features for one single small frame of
+ * audio data e.g. 640 samples.
+ * @param[in] audioData Vector of audio samples to calculate
+ * features for.
+ * @return Vector of extracted MFCC features.
+ **/
+ std::vector<float> MfccCompute(const std::vector<int16_t>& audioData);
+
+ /** @brief Initialise. */
+ void Init();
+
+ /**
+ * @brief Extract MFCC features and quantise for one single small
+ * frame of audio data e.g. 640 samples.
+ * @param[in] audioData Vector of audio samples to calculate
+ * features for.
+ * @param[in] quantScale Quantisation scale.
+ * @param[in] quantOffset Quantisation offset.
+ * @return Vector of extracted quantised MFCC features.
+ **/
+ template<typename T>
+ std::vector<T> MfccComputeQuant(const std::vector<int16_t>& audioData,
+ const float quantScale,
+ const int quantOffset)
+ {
+ this->_MfccComputePreFeature(audioData);
+ float minVal = std::numeric_limits<T>::min();
+ float maxVal = std::numeric_limits<T>::max();
+
+ std::vector<T> mfccOut(this->_m_params.m_numMfccFeatures);
+ const size_t numFbankBins = this->_m_params.m_numFbankBins;
+
+ /* Take DCT. Uses matrix mul. */
+ for (size_t i = 0, j = 0; i < mfccOut.size(); ++i, j += numFbankBins) {
+ float sum = 0;
+ for (size_t k = 0; k < numFbankBins; ++k) {
+ sum += this->_m_dctMatrix[j + k] * this->_m_melEnergies[k];
+ }
+ /* Quantize to T. */
+ sum = std::round((sum / quantScale) + quantOffset);
+ mfccOut[i] = static_cast<T>(std::min<float>(std::max<float>(sum, minVal), maxVal));
+ }
+
+ return mfccOut;
+ }
+
+ /* Constants */
+ static constexpr float ms_logStep = /*logf(6.4)*/ 1.8562979903656 / 27.0;
+ static constexpr float ms_freqStep = 200.0 / 3;
+ static constexpr float ms_minLogHz = 1000.0;
+ static constexpr float ms_minLogMel = ms_minLogHz / ms_freqStep;
+
+ protected:
+ /**
+ * @brief Project input frequency to Mel Scale.
+ * @param[in] freq Input frequency in floating point.
+ * @param[in] useHTKmethod bool to signal if HTK method is to be
+ * used for calculation.
+ * @return Mel transformed frequency in floating point.
+ **/
+ static float MelScale(float freq,
+ bool useHTKMethod = true);
+
+ /**
+ * @brief Inverse Mel transform - convert MEL warped frequency
+ * back to normal frequency.
+ * @param[in] freq Mel frequency in floating point.
+ * @param[in] useHTKmethod bool to signal if HTK method is to be
+ * used for calculation.
+ * @return Real world frequency in floating point.
+ **/
+ static float InverseMelScale(float melFreq,
+ bool useHTKMethod = true);
+
+ /**
+ * @brief Populates MEL energies after applying the MEL filter
+ * bank weights and adding them up to be placed into
+ * bins, according to the filter bank's first and last
+ * indices (pre-computed for each filter bank element
+ * by _CreateMelFilterBank function).
+ * @param[in] fftVec Vector populated with FFT magnitudes.
+ * @param[in] melFilterBank 2D Vector with filter bank weights.
+ * @param[in] filterBankFilterFirst Vector containing the first indices of filter bank
+ * to be used for each bin.
+ * @param[in] filterBankFilterLast Vector containing the last indices of filter bank
+ * to be used for each bin.
+ * @param[out] melEnergies Pre-allocated vector of MEL energies to be
+ * populated.
+ * @return true if successful, false otherwise.
+ */
+ virtual bool ApplyMelFilterBank(
+ std::vector<float>& fftVec,
+ std::vector<std::vector<float>>& melFilterBank,
+ std::vector<int32_t>& filterBankFilterFirst,
+ std::vector<int32_t>& filterBankFilterLast,
+ std::vector<float>& melEnergies);
+
+ /**
+ * @brief Converts the Mel energies for logarithmic scale.
+ * @param[in,out] melEnergies 1D vector of Mel energies.
+ **/
+ virtual void ConvertToLogarithmicScale(std::vector<float>& melEnergies);
+
+ /**
+ * @brief Create a matrix used to calculate Discrete Cosine
+ * Transform.
+ * @param[in] inputLength Input length of the buffer on which
+ * DCT will be performed.
+ * @param[in] coefficientCount Total coefficients per input length.
+ * @return 1D vector with inputLength x coefficientCount elements
+ * populated with DCT coefficients.
+ */
+ virtual std::vector<float> CreateDCTMatrix(
+ int32_t inputLength,
+ int32_t coefficientCount);
+
+ /**
+ * @brief Given the low and high Mel values, get the normaliser
+ * for weights to be applied when populating the filter
+ * bank.
+ * @param[in] leftMel Low Mel frequency value.
+ * @param[in] rightMel High Mel frequency value.
+ * @param[in] useHTKMethod bool to signal if HTK method is to be
+ * used for calculation.
+ * @return Value to use for normalizing.
+ */
+ virtual float GetMelFilterBankNormaliser(
+ const float& leftMel,
+ const float& rightMel,
+ bool useHTKMethod);
+
+ private:
+ MfccParams _m_params;
+ std::vector<float> _m_frame;
+ std::vector<float> _m_buffer;
+ std::vector<float> _m_melEnergies;
+ std::vector<float> _m_windowFunc;
+ std::vector<std::vector<float>> _m_melFilterBank;
+ std::vector<float> _m_dctMatrix;
+ std::vector<int32_t> _m_filterBankFilterFirst;
+ std::vector<int32_t> _m_filterBankFilterLast;
+ bool _m_filterBankInitialised;
+ arm::app::math::FftInstance _m_fftInstance;
+
+ /**
+ * @brief Initialises the filter banks and the DCT matrix. **/
+ void _InitMelFilterBank();
+
+ /**
+ * @brief Signals whether the instance of MFCC has had its
+ * required buffers initialised.
+ * @return true if initialised, false otherwise.
+ **/
+ bool _IsMelFilterBankInited();
+
+ /**
+ * @brief Create mel filter banks for MFCC calculation.
+ * @return 2D vector of floats.
+ **/
+ std::vector<std::vector<float>> _CreateMelFilterBank();
+
+ /**
+ * @brief Computes and populates internal memeber buffers used
+ * in MFCC feature calculation
+ * @param[in] audioData 1D vector of 16-bit audio data.
+ */
+ void _MfccComputePreFeature(const std::vector<int16_t>& audioData);
+
+ /** @brief Computes the magnitude from an interleaved complex array. */
+ void _ConvertToPowerSpectrum();
+
+ };
+
+} /* namespace audio */
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* MFCC_HPP */ \ No newline at end of file
diff --git a/source/application/main/include/PlatformMath.hpp b/source/application/main/include/PlatformMath.hpp
new file mode 100644
index 0000000..45e6a9e
--- /dev/null
+++ b/source/application/main/include/PlatformMath.hpp
@@ -0,0 +1,151 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef PLATFORM_MATH_HPP
+#define PLATFORM_MATH_HPP
+
+#include "hal.h"
+
+/* See if ARM DSP functions can be used. */
+#if PLATFORM_HAL == PLATFORM_CORTEX_M_BAREMETAL
+ #if defined(__DSP_PRESENT) && (__DSP_PRESENT == 1U)
+
+ #define ARM_DSP_AVAILABLE (1U)
+ #include "arm_math.h"
+ #define M_PI (PI)
+
+ #endif /* defined(__DSP_PRESENT) && (__DSP_PRESENT == 1U) */
+#endif /* PLATFORM_HAL == PLATFORM_CORTEX_M_BAREMETAL */
+
+#include <vector>
+
+namespace arm {
+namespace app {
+namespace math {
+
+ struct FftInstance {
+#if ARM_DSP_AVAILABLE
+ arm_rfft_fast_instance_f32 instance;
+#endif
+ bool initialised = false;
+ };
+
+ /* Class to provide Math functions like FFT, mean, stddev etc.
+ * This will allow other classes, functions to be independent of
+ * #if definition checks and provide a cleaner API. Also, it will
+ * consolidate all arm math functions used in one place and make
+ * them easier to test. */
+ class MathUtils {
+
+ public:
+ /**
+ * @brief Get the cosine value of the argument in floating point.
+ * @param[in] radians Angle in radians.
+ * @return Cosine value (floating point).
+ */
+ static float CosineF32(float radians);
+
+ /**
+ * @brief Get the square root of the argument in floating point.
+ * @param[in] input Value to compute square root of.
+ * @return Square root (floating point) value.
+ */
+ static float SqrtF32(float input);
+
+ /**
+ * @brief Gets the mean of a floating point array of elements.
+ * @param[in] ptrSrc Pointer to the first element.
+ * @param[in] srcLen Number of elements in the array/vector.
+ * @return Average value.
+ */
+ static float MeanF32(float* ptrSrc, uint32_t srcLen);
+
+ /**
+ * @brief Gets the standard deviation of a floating point array
+ * of elements.
+ * @param[in] ptrSrc Pointer to the first element.
+ * @param[in] srcLen Number of elements in the array/vector.
+ * @param[in] mean Pre-computed mean value.
+ * @return Standard deviation value.
+ */
+ static float StdDevF32(float* ptrSrc, uint32_t srcLen,
+ float mean);
+
+ /**
+ * @brief Initialises the internal FFT structures (if available
+ * for the platform). This function should be called
+ * prior to Fft32 function call if built with ARM DSP functions.
+ * @param[in] fftLen Requested length of the FFT.
+ * @param[in] fftInstance FFT instance struct to use.
+ * @return true if successful, false otherwise.
+ */
+ static bool FftInitF32(const uint16_t fftLen, arm::app::math::FftInstance& fftInstance);
+
+ /**
+ * @brief Computes the FFT for the input vector.
+ * @param[in] input Floating point vector of input elements
+ * @param[out] fftOutput Output buffer to be populated by computed FFTs.
+ * @param[in] fftInstance FFT instance struct to use.
+ */
+ static void FftF32(std::vector<float>& input,
+ std::vector<float>& fftOutput,
+ arm::app::math::FftInstance& fftInstance);
+
+ /**
+ * @brief Computes the natural logarithms of input floating point
+ * vector
+ * @param[in] input Floating point input vector
+ * @param[out] output Pre-allocated buffer to be populated with
+ * natural log values of each input element.
+ */
+ static void VecLogarithmF32(std::vector <float>& input,
+ std::vector <float>& output);
+
+ /**
+ * @brief Computes the dot product of two 1D floating point
+ * vectors.
+ * result = sum(srcA[0]*srcB[0] + srcA[1]*srcB[1] + ..)
+ * @param[in] srcPtrA Pointer to the first element of first
+ * array.
+ * @param[in] srcPtrB Pointer to the first element of second
+ * array.
+ * @param[in] srcLen Number of elements in the array/vector.
+ * @return Dot product.
+ */
+ static float DotProductF32(float* srcPtrA, float* srcPtrB,
+ const uint32_t srcLen);
+
+ /**
+ * @brief Computes the squared magnitude of floating point
+ * complex number array.
+ * @param[in] ptrSrc Pointer to the first element of input
+ * array.
+ * @param[in] srcLen Number of elements in the array/vector.
+ * @param[out] ptrDst Output buffer to be populated.
+ * @param[in] dstLen Output buffer len (for sanity check only).
+ * @return true if successful, false otherwise.
+ */
+ static bool ComplexMagnitudeSquaredF32(float* ptrSrc,
+ const uint32_t srcLen,
+ float* ptrDst,
+ const uint32_t dstLen);
+
+ };
+} /* namespace math */
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* PLATFORM_MATH_HPP */ \ No newline at end of file
diff --git a/source/application/main/include/Profiler.hpp b/source/application/main/include/Profiler.hpp
new file mode 100644
index 0000000..b16a63b
--- /dev/null
+++ b/source/application/main/include/Profiler.hpp
@@ -0,0 +1,110 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef APP_PROFILER_HPP
+#define APP_PROFILER_HPP
+
+#include "hal.h"
+
+#include <string>
+#include <map>
+#include <vector>
+
+namespace arm {
+namespace app {
+
+ /** A single profiling unit definition. */
+ struct ProfilingUnit {
+ uint64_t npuCycles = 0;
+ uint64_t activeNpuCycles = 0;
+ uint64_t cpuCycles = 0;
+ time_t time = 0;
+ };
+
+ /* A collection of profiling units. */
+ using ProfilingSeries = std::vector<arm::app::ProfilingUnit>;
+
+ /* A map for string identifiable profiling series. */
+ using ProfilingMap = std::map<std::string, ProfilingSeries>;
+
+ /**
+ * @brief A very simple profiler example using the platform timer
+ * implementation.
+ */
+ class Profiler {
+ public:
+ /**
+ * @brief Constructor for profiler.
+ * @param[in] platform Pointer to a valid, initialised hal platform.
+ * @param[in] name A friendly name for this profiler.
+ **/
+ Profiler(hal_platform* platform, const char* name);
+
+ /** Block the default constructor. */
+ Profiler() = delete;
+
+ /** Default destructor. */
+ ~Profiler() = default;
+
+ /** @brief Start profiling => get starting time-stamp. */
+ bool StartProfiling(const char* name = nullptr);
+
+ /** @brief Stop profiling => get the ending time-stamp. */
+ bool StopProfiling();
+
+ /** @brief Stops the profiling and internally resets the
+ * platform timers. */
+ bool StopProfilingAndReset();
+
+ /** @brief Reset the platform timers. */
+ void Reset();
+
+ /**
+ * @brief Gets the results as string and resets the profiler.
+ * @returns Result string.
+ **/
+ std::string GetResultsAndReset();
+
+ /** @brief Set the profiler name. */
+ void SetName(const char* str);
+
+ private:
+ ProfilingMap _m_series; /* Profiling series map. */
+ time_counter _m_tstampSt; /* Container for a current starting timestamp. */
+ time_counter _m_tstampEnd; /* Container for a current ending timestamp. */
+ hal_platform * _m_pPlatform = nullptr; /* Platform pointer - to get the timer. */
+
+ bool _m_started = false; /* Indicates profiler has been started. */
+
+ std::string _m_name; /* Name given to this profiler. */
+
+ /**
+ * @brief Appends the profiling unit computed by the "start" and
+ * "end" timestamps to the profiling series identified by
+ * the name provided.
+ * @param[in] start Starting time-stamp.
+ * @param[in] end Ending time-stamp.
+ * @param[in] name Name for the profiling unit series to be
+ * appended to.
+ **/
+ void _AddProfilingUnit(time_counter start, time_counter end,
+ const std::string& name);
+ };
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* APP_PROFILER_HPP */
diff --git a/source/application/main/include/UseCaseCommonUtils.hpp b/source/application/main/include/UseCaseCommonUtils.hpp
new file mode 100644
index 0000000..02200e8
--- /dev/null
+++ b/source/application/main/include/UseCaseCommonUtils.hpp
@@ -0,0 +1,76 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef USECASE_COMMON_UTILS_HPP
+#define USECASE_COMMON_UTILS_HPP
+
+#include "hal.h"
+#include "Model.hpp"
+#include "AppContext.hpp"
+#include "Profiler.hpp"
+
+/* Helper macro to convert RGB888 to RGB565 format. */
+#define RGB888_TO_RGB565(R8,G8,B8) ((((R8>>3) & 0x1F) << 11) | \
+ (((G8>>2) & 0x3F) << 5) | \
+ ((B8>>3) & 0x1F))
+
+constexpr uint16_t COLOR_BLACK = 0;
+constexpr uint16_t COLOR_GREEN = RGB888_TO_RGB565( 0, 255, 0); // 2016;
+constexpr uint16_t COLOR_YELLOW = RGB888_TO_RGB565(255, 255, 0); // 65504;
+
+namespace arm {
+namespace app {
+
+ /**
+ * @brief Run inference using given model
+ * object. If profiling is enabled, it will log the
+ * statistics too.
+ * @param[in] platform Reference to the hal platform object.
+ * @param[in] model Reference to the initialised model.
+ * @return true if inference succeeds, false otherwise.
+ **/
+ bool RunInference(hal_platform& platform, arm::app::Model& model);
+
+ /**
+ * @brief Read input and return as an integer.
+ * @param[in] platform Reference to the hal platform object.
+ * @param[in] model Reference to the initialised model.
+ * @return Integer value corresponding to the user input.
+ **/
+ int ReadUserInputAsInt(hal_platform& platform);
+
+#if VERIFY_TEST_OUTPUT
+ /**
+ * @brief Helper function to dump a tensor to stdout
+ * @param[in] tensor tensor to be dumped
+ * @param[in] lineBreakForNumElements number of elements
+ * after which line break will be added.
+ **/
+ void DumpTensor(TfLiteTensor* tensor,
+ const size_t lineBreakForNumElements = 16);
+#endif /* VERIFY_TEST_OUTPUT */
+
+ /**
+ * @brief List the files baked in the application.
+ * @param[in] ctx Reference to the application context.
+ * @return true or false based on event being handled.
+ **/
+ bool ListFilesHandler(ApplicationContext& ctx);
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* USECASE_COMMON_UTILS_HPP */ \ No newline at end of file
generated by cgit v1.2.1 (git 2.23.0) at 2024-06-17 11:41:04 +0000